0 of 44 questions completed
Questions:
You have already completed the quiz before. Hence you can not start it again.
Quiz is loading…
You must sign in or sign up to start the quiz.
You must first complete the following:
0 of 44 questions answered correctly
Your time:
Time has elapsed
You have reached 0 of 0 point(s), (0)
Earned Point(s): 0 of 0, (0)
0 Essay(s) Pending (Possible Point(s): 0)
Which carboxylic acid is used to prepare the ester shown?
What type of compound is formed when a carboxylic acid reacts with an alcohol in the presence of an acid catalyst?
Which of the following is not a dicarboxylic acid?
What is the major organic product of the reaction shown?
1. | |
2. | |
3. | |
4. | |
5. | CH3CH2CH2CH2OCH2OCH(CH3)2 |
Which of the following occurs during Fischer esterification?
What is the IUPAC name for the following compound?
When alcohol reacts with a carboxylic acid the major product is a(n):
Saponification is an example of which type of reaction?
Which of the following unsaturated acids has the fewest double bonds?
Which of the following might be obtained as one of the products in this reaction?
1 | CH3CH2−OH |
2 | |
3 | |
4 | |
Which of the following is true of the Fischer esterification reaction?
What is the name of the compound produced by the reaction of benzoic acid with sodium hydroxide?
The common chemical name of aspirin is:
Which of the following is a major component of kidney stones?
Which of the following is true of the sources of fatty acids?
Which equation correctly represents the dissociation of a carboxylic acid in the water?
Which of the following is the correct IUPAC name of a carboxylic acid which contains five carbon atoms?
What is the IUPAC name for the following compound?
The products of acid hydrolysis of an ester are:
Consider the following reaction. (R, R’, and R” represent different hydrocarbon chains.)
Which of the following correctly describes this reaction?
Examine the following cut-away figure.
Which of the following correctly describes this structure?
The reactants needed to produce simple polyesters are
Which of the following is a byproduct in the production of soaps?
Which of the following is obtained by the decarboxylation of oxalosuccinic acid?
The products of basic hydrolysis of an ester are
Which of the following compounds will be the weakest acid?
Which carboxylic acids undergo decarboxylation quite readily on mild heating?
Examine the following figure.
Which of the following does it represent? |
The decarboxylation of α-ketoglutaric acid requires which of the following?
Which of the following is true of fatty acids?
Which of the following acids is not found in abundance in animal fats and vegetable oils?
Which of the following acids is used in the synthesis of the polymer nylon-66?
Which of the following can be used as a fungal growth inhibitor?
Which of the following fatty acids is(are) unsaturated?
What is the IUPAC name of the following compound?
Which of the following compounds will be the strongest acid?
Which of the following intermolecular forces is most different between saturated and cis-unsaturated fatty acids of comparable size?
Which of the following compounds will react with sodium hydroxide to form a water-soluble product?
What would you expect is the order of water solubility for the following compounds:
The sour taste of pickles and sauerkraut is due primarily to the presence of which acid?
Which of the following is true of most abundant, naturally occurring, unsaturated fatty acids?
How many carboxylic acids have the molecular formula C5H10O2?
The reactions of a carboxylic acid with which of the following reagents produces a gas?
Consider a mixture of cinnamaldehyde and cinnamic acid that is subjected to the procedure shown in the flow diagram.
Which of the following describes the fate of the cinnamic acid. |